CAS 17327-33-2 appears in our catalog under these names: 4,4,4-Trifluoro-3-(trifluoromethyl)butyric acid, 98%, 4,4,4-Trifluoro-3-(trifluoromethyl)butanoic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 250mg.
4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid (CAS 17327-33-2) is a chemical compound with the molecular formula C5H4F6O2 and a molecular weight of 210.07 g/mol. IUPAC name: 4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid. InChIKey: BXOJQJKUSQRUKV-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O2 |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
| InChIKey | BXOJQJKUSQRUKV-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)