CAS 360-54-3 appears in our catalog under these names: Methyl 2-(trifluoromethyl)-3,3,3-trifluoropropionate, 95%, Methyl 3,3,3-trifluoro-2-(trifluoromethyl)propanoate, 95%, Methyl 2–(Trifluoromethyl)–3，3，3–trifluoropropionate, Methyl 2-(Trifluoromethyl)-3,3,3-trifluoropropionate, >98.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 1g, 5g, 200mg.
Methyl 3,3,3-trifluoro-2-(trifluoromethyl)propanoate (CAS 360-54-3) is a chemical compound with the molecular formula C5H4F6O2 and a molecular weight of 210.07 g/mol. IUPAC name: methyl 3,3,3-trifluoro-2-(trifluoromethyl)propanoate. InChIKey: JGGBVFLRNNDHCM-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O2 |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | methyl 3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| InChIKey | JGGBVFLRNNDHCM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)