CAS 1765-26-0 appears in our catalog under these names: 2,2-Bis(trifluoromethyl)-1,3-dioxolane, 95%, 2,2-Bis(trifluoromethyl)-1,3-dioxolane, 95+%, 2,2-Bis(trifluoromethyl)-1,3-dioxolane, 2,2-Bis(trifluoromethyl)-1,3-dioxolane, >98.0%(GC), 2,2-Bis(trifluoromethyl)-1,3-dioxolane 95+%. Offered by: Combi-blocks, AmBeed, TRC, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg.
2,2-bis(trifluoromethyl)-1,3-dioxolane (CAS 1765-26-0) is a chemical compound with the molecular formula C5H4F6O2 and a molecular weight of 210.07 g/mol. IUPAC name: 2,2-bis(trifluoromethyl)-1,3-dioxolane. InChIKey: PQNNUQKDERZMPQ-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O2 |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 2,2-bis(trifluoromethyl)-1,3-dioxolane |
| InChIKey | PQNNUQKDERZMPQ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)