CAS 173294-74-1 is the registry number for Garciniaxanthone E. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4,6,8-tetrahydroxy-1-(3-methylbut-2-enyl)xanthen-9-one (CAS 173294-74-1) is a chemical compound with the molecular formula C28H32O6 and a molecular weight of 464.5 g/mol. IUPAC name: 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4,6,8-tetrahydroxy-1-(3-methylbut-2-enyl)xanthen-9-one. InChIKey: BRKFTRQHPIQVNO-LICLKQGHSA-N.
| Molecular formula | C28H32O6 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4,6,8-tetrahydroxy-1-(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | BRKFTRQHPIQVNO-LICLKQGHSA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C2=C(C(=C1O)O)OC3=CC(=CC(=C3C2=O)O)O)CC=C(C)C)/C)C |
Computed by PubChem (NCBI)