CAS 173458-56-5 is the registry number for CGP-59326. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3-chlorophenyl)-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CAS 173458-56-5) is a chemical compound with the molecular formula C14H13ClN4 and a molecular weight of 272.73 g/mol. IUPAC name: N-(3-chlorophenyl)-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: WXJDWBDGDSXEFA-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4 |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | N-(3-chlorophenyl)-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | WXJDWBDGDSXEFA-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=NC=N2)NC3=CC(=CC=C3)Cl)C |
Computed by PubChem (NCBI)