CAS 1735-87-1 is the registry number for 2,2-Bis(trifluoromethyl)propionyl fluoride. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride (CAS 1735-87-1) is a chemical compound with the molecular formula C5H3F7O and a molecular weight of 212.07 g/mol. IUPAC name: 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride. InChIKey: LKMMDSMLDJMRSU-UHFFFAOYSA-N.
| Molecular formula | C5H3F7O |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride |
| InChIKey | LKMMDSMLDJMRSU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)