Products 1735-87-1

CAS 1735-87-1 is the registry number for 2,2-Bis(trifluoromethyl)propionyl fluoride. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride (CAS 1735-87-1) is a chemical compound with the molecular formula C5H3F7O and a molecular weight of 212.07 g/mol. IUPAC name: 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride. InChIKey: LKMMDSMLDJMRSU-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3F7O
Molecular weight212.07 g/mol
IUPAC name3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoyl fluoride
InChIKeyLKMMDSMLDJMRSU-UHFFFAOYSA-N
SMILESCC(C(=O)F)(C(F)(F)F)C(F)(F)F

Computed by PubChem (NCBI)