CAS 355-17-9 is the registry number for Methyl heptafluoropropyl ketone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,3,4,4,5,5,5-heptafluoropentan-2-one (CAS 355-17-9) is a chemical compound with the molecular formula C5H3F7O and a molecular weight of 212.07 g/mol. IUPAC name: 3,3,4,4,5,5,5-heptafluoropentan-2-one. InChIKey: XJYXROGTQYHLTH-UHFFFAOYSA-N.
| Molecular formula | C5H3F7O |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 3,3,4,4,5,5,5-heptafluoropentan-2-one |
| InChIKey | XJYXROGTQYHLTH-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)