CAS 360-53-2 is the registry number for 1,1,1,3-Tetrafluoro-2-(trifluoromethyl)-4-oxapent-2-ene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1,3,3,3-tetrafluoro-1-methoxy-2-(trifluoromethyl)prop-1-ene (CAS 360-53-2) is a chemical compound with the molecular formula C5H3F7O and a molecular weight of 212.07 g/mol. IUPAC name: 1,3,3,3-tetrafluoro-1-methoxy-2-(trifluoromethyl)prop-1-ene. InChIKey: FSDLLONBRLBIBL-UHFFFAOYSA-N.
| Molecular formula | C5H3F7O |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 1,3,3,3-tetrafluoro-1-methoxy-2-(trifluoromethyl)prop-1-ene |
| InChIKey | FSDLLONBRLBIBL-UHFFFAOYSA-N |
| SMILES | COC(=C(C(F)(F)F)C(F)(F)F)F |
Computed by PubChem (NCBI)