Products 17354-60-8
CAS 17354-60-8 appears in our catalog under these names: 3-Amino-N,N-diethyl-4-methyl-benzenesulfonamide, 98%, 3-Amino-N,N-diethyl-4-methyl-benzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 25g, 1g, 2,5g.
3-amino-N,N-diethyl-4-methylbenzenesulfonamide (CAS 17354-60-8) is a chemical compound with the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. IUPAC name: 3-amino-N,N-diethyl-4-methylbenzenesulfonamide. InChIKey: URPZZPGQCSFZLH-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | 3-amino-N,N-diethyl-4-methylbenzenesulfonamide |
| InChIKey | URPZZPGQCSFZLH-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)C)N |
Computed by PubChem (NCBI)