Products 869949-51-9
CAS 869949-51-9 is the registry number for 2,3,4,5,6-Pentamethylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,3,4,5,6-pentamethylbenzenesulfonohydrazide (CAS 869949-51-9) is a chemical compound with the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. IUPAC name: 2,3,4,5,6-pentamethylbenzenesulfonohydrazide. InChIKey: AFWXWVWVTZYRDF-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | 2,3,4,5,6-pentamethylbenzenesulfonohydrazide |
| InChIKey | AFWXWVWVTZYRDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)S(=O)(=O)NN)C)C |
Computed by PubChem (NCBI)