CAS 72225-63-9 appears in our catalog under these names: 3-Amino-N-butyl-4-methylbenzenesulfonamide, 98%, 3-Amino-N-butyl-4-methylbenzenesulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 100g, 5g, 1g, 500g, 2,5g, 0,25g.
3-amino-N-butyl-4-methylbenzenesulfonamide (CAS 72225-63-9) is a chemical compound with the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. IUPAC name: 3-amino-N-butyl-4-methylbenzenesulfonamide. InChIKey: BROLIXCWOLRQGA-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | 3-amino-N-butyl-4-methylbenzenesulfonamide |
| InChIKey | BROLIXCWOLRQGA-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=CC(=C(C=C1)C)N |
Computed by PubChem (NCBI)