Products 173898-15-2

CAS 173898-15-2 is the registry number for (R)-4-(1-(((Benzyloxy)carbonyl)amino)ethyl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

4-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]benzoic acid (CAS 173898-15-2) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: 4-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]benzoic acid. InChIKey: XZHNWUGYLBANCU-GFCCVEGCSA-N.

Identity
Molecular formulaC17H17NO4
Molecular weight299.32 g/mol
IUPAC name4-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]benzoic acid
InChIKeyXZHNWUGYLBANCU-GFCCVEGCSA-N
SMILESC[C@H](C1=CC=C(C=C1)C(=O)O)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)