CAS 17392-67-5 appears in our catalog under these names: 1-(2-Methoxy-5-nitrophenyl)-1h-pyrrole-2,5-dione, 95%, 1-(2-Methoxy-5-nitrophenyl)-1H-pyrrole-2,5-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 10g, 1g, 5g, 2,5g.
1-(2-methoxy-5-nitrophenyl)pyrrole-2,5-dione (CAS 17392-67-5) is a chemical compound with the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. IUPAC name: 1-(2-methoxy-5-nitrophenyl)pyrrole-2,5-dione. InChIKey: RQSBMFYAHQPZGS-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O5 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 1-(2-methoxy-5-nitrophenyl)pyrrole-2,5-dione |
| InChIKey | RQSBMFYAHQPZGS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)