Products 2940-25-2
CAS 2940-25-2 is the registry number for 5-Methyl-2-(4-nitrophenyl)oxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-2-(4-nitrophenyl)-1,3-oxazole-4-carboxylic acid (CAS 2940-25-2) is a chemical compound with the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. IUPAC name: 5-methyl-2-(4-nitrophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: MTFFQEVXXGGPMM-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O5 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 5-methyl-2-(4-nitrophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | MTFFQEVXXGGPMM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)