CAS 91135-91-0 appears in our catalog under these names: 1-(4-Methoxy-2-nitro-phenyl)-pyrrole-2,5-dione, 95%, 1-(4-Methoxy-2-nitrophenyl)-2,5-dihydro-1Hpyrrole-2,5-dione (>85%), 1-(4-Methoxy-2-nitrophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 500mg, 50mg.
1-(4-methoxy-2-nitrophenyl)pyrrole-2,5-dione (CAS 91135-91-0) is a chemical compound with the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. IUPAC name: 1-(4-methoxy-2-nitrophenyl)pyrrole-2,5-dione. InChIKey: ZHWGRLDBELYMCJ-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O5 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 1-(4-methoxy-2-nitrophenyl)pyrrole-2,5-dione |
| InChIKey | ZHWGRLDBELYMCJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N2C(=O)C=CC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)