Products 17398-07-1
CAS 17398-07-1 is the registry number for Heteropeucenin. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,7-dihydroxy-2-methyl-8-(3-methylbut-2-enyl)chromen-4-one (CAS 17398-07-1) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 260.28 g/mol. IUPAC name: 5,7-dihydroxy-2-methyl-8-(3-methylbut-2-enyl)chromen-4-one. InChIKey: WUPLGASUDBCHAH-UHFFFAOYSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 5,7-dihydroxy-2-methyl-8-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | WUPLGASUDBCHAH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(C=C(C(=C2O1)CC=C(C)C)O)O |
Computed by PubChem (NCBI)