Products 173989-75-8

CAS 173989-75-8 is the registry number for 1-((1S)-1-Phenylethyl)-1H-pyrrole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-[(1S)-1-phenylethyl]pyrrole-2-carboxylic acid (CAS 173989-75-8) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 1-[(1S)-1-phenylethyl]pyrrole-2-carboxylic acid. InChIKey: BFLKSSGFEWKBMW-JTQLQIEISA-N.

Identity
Molecular formulaC13H13NO2
Molecular weight215.25 g/mol
IUPAC name1-[(1S)-1-phenylethyl]pyrrole-2-carboxylic acid
InChIKeyBFLKSSGFEWKBMW-JTQLQIEISA-N
SMILESC[C@@H](C1=CC=CC=C1)N2C=CC=C2C(=O)O

Computed by PubChem (NCBI)