Products 17399-24-5
CAS 17399-24-5 is the registry number for 3-(Phenethyloxy)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(2-phenylethoxy)aniline;hydrochloride (CAS 17399-24-5) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: 3-(2-phenylethoxy)aniline;hydrochloride. InChIKey: NSMNJRBKWVFPPZ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | 3-(2-phenylethoxy)aniline;hydrochloride |
| InChIKey | NSMNJRBKWVFPPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCOC2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(2-phenylethoxy)aniline hydrochloride, 3-Phenethoxyaniline hydrochloride, 3-(2-phenylethoxy)aniline;hydrochloride, 3-(2-phenylethoxy)phenylamine, chloride, [3-(2-phenylethoxy)phenyl]amine hydrochloride, 3-Phenethoxyanilinehydrochloride, 3-(2-Phenylethoxy)aniline (HCl), 3-(2-Phenylethoxy)aniline--hydrogen chloride (1/1)