Products 17413-73-9

CAS 17413-73-9 is the registry number for 2-(3-Chlorophenoxy)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-chlorophenoxy)-2-methylpropanoic acid (CAS 17413-73-9) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 2-(3-chlorophenoxy)-2-methylpropanoic acid. InChIKey: PZBIVIXQLIVFHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO3
Molecular weight214.64 g/mol
IUPAC name2-(3-chlorophenoxy)-2-methylpropanoic acid
InChIKeyPZBIVIXQLIVFHJ-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)OC1=CC(=CC=C1)Cl

Computed by PubChem (NCBI)