Products 174309-29-6
CAS 174309-29-6 is the registry number for trans-2,4-diethyl-1-benzylazetidine-2,4-dicarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 25g.
Diethyl (2S,4S)-1-benzylazetidine-2,4-dicarboxylate (CAS 174309-29-6) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: diethyl (2S,4S)-1-benzylazetidine-2,4-dicarboxylate. InChIKey: DXLXLBWDINXHBH-KBPBESRZSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | diethyl (2S,4S)-1-benzylazetidine-2,4-dicarboxylate |
| InChIKey | DXLXLBWDINXHBH-KBPBESRZSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H](N1CC2=CC=CC=C2)C(=O)OCC |
Computed by PubChem (NCBI)