CAS 174366-01-9 appears in our catalog under these names: AGN 194204 Impurity 3, (Z)-3-(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)but-2-en-1-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(Z)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-en-1-ol (CAS 174366-01-9) is a chemical compound with the molecular formula C18H26O and a molecular weight of 258.4 g/mol. IUPAC name: (Z)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-en-1-ol. InChIKey: LCICCPOYRCXFMX-JYRVWZFOSA-N.
| Molecular formula | C18H26O |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | (Z)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-en-1-ol |
| InChIKey | LCICCPOYRCXFMX-JYRVWZFOSA-N |
| SMILES | C/C(=C/CO)/C1=CC2=C(C=C1)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)