Products 86530-28-1
CAS 86530-28-1 is the registry number for Beta-apo-13-carotenone d3. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(3E,5E,7E)-1,1,1-trideuterio-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-one (CAS 86530-28-1) is a chemical compound with the molecular formula C18H26O and a molecular weight of 261.4 g/mol. IUPAC name: (3E,5E,7E)-1,1,1-trideuterio-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-one. InChIKey: UBTNVRPIHJRBCI-UUTGIGQUSA-N.
| Molecular formula | C18H26O |
|---|---|
| Molecular weight | 261.4 g/mol |
| IUPAC name | (3E,5E,7E)-1,1,1-trideuterio-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-one |
| InChIKey | UBTNVRPIHJRBCI-UUTGIGQUSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)/C=C/C=C(\C)/C=C/C1=C(CCCC1(C)C)C |
Computed by PubChem (NCBI)