CAS 3646-28-4 appears in our catalog under these names: Estr-4-en-17-one, Allylestrenol Impurity A. Offered by: TRC, Biosynth, Chemat Brand. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, on request.
(8R,9S,10R,13S,14S)-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (CAS 3646-28-4) is a chemical compound with the molecular formula C18H26O and a molecular weight of 258.4 g/mol. IUPAC name: (8R,9S,10R,13S,14S)-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one. InChIKey: OLYAEHZZXXLNQQ-QXUSFIETSA-N.
| Molecular formula | C18H26O |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S)-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| InChIKey | OLYAEHZZXXLNQQ-QXUSFIETSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=CCCC[C@H]34 |
Computed by PubChem (NCBI)