CAS 174393-13-6 is the registry number for LY307452. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,4S)-2-amino-4-(4,4-diphenylbutyl)pentanedioic acid (CAS 174393-13-6) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,4S)-2-amino-4-(4,4-diphenylbutyl)pentanedioic acid. InChIKey: DWLOVDOPFJPWNE-HKUYNNGSSA-N.
| Molecular formula | C21H25NO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,4S)-2-amino-4-(4,4-diphenylbutyl)pentanedioic acid |
| InChIKey | DWLOVDOPFJPWNE-HKUYNNGSSA-N |
| SMILES | C1=CC=C(C=C1)C(CCC[C@@H](C[C@@H](C(=O)O)N)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)