Products 174603-55-5
CAS 174603-55-5 appears in our catalog under these names: 3–(2–Bromo–4–fluorophenyl)propionic acid, 3-(2-Bromo-4-fluorophenyl)propionic acid 97%, 3-(2-Bromo-4-Fluorophenyl)Propionic Acid, 98%, 98%, 3-(2-Bromo-4-fluorophenyl)propionic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-(2-bromo-4-fluorophenyl)propanoic acid (CAS 174603-55-5) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 3-(2-bromo-4-fluorophenyl)propanoic acid. InChIKey: VHFQIJJCQTZKFK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 3-(2-bromo-4-fluorophenyl)propanoic acid |
| InChIKey | VHFQIJJCQTZKFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)CCC(=O)O |
Computed by PubChem (NCBI)