Products 174605-91-5

CAS 174605-91-5 is the registry number for 1-tert-Butyl 4-ethyl 4-(4-chlorobenzyl)piperidine-1,4-dicarboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-ethyl 4-[(4-chlorophenyl)methyl]piperidine-1,4-dicarboxylate (CAS 174605-91-5) is a chemical compound with the molecular formula C20H28ClNO4 and a molecular weight of 381.9 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-[(4-chlorophenyl)methyl]piperidine-1,4-dicarboxylate. InChIKey: QTVIWIWJGWSTDC-UHFFFAOYSA-N.

Identity
Molecular formulaC20H28ClNO4
Molecular weight381.9 g/mol
IUPAC name1-O-tert-butyl 4-O-ethyl 4-[(4-chlorophenyl)methyl]piperidine-1,4-dicarboxylate
InChIKeyQTVIWIWJGWSTDC-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CC2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)