Products 22235-98-9
CAS 22235-98-9 appears in our catalog under these names: Hyoscine Butylbromide EP Impurity E HCl, N-Butyl Nor Scopolamine Hydrochloride, >95% (HPLC), (1R,2R,4S,5S,7s)-9-Butyl-3-oxa-9-azatricyclo(3.3.1.02,4)nonan-7-yl (2S)-3-Hydroxy-2-phenylpropanoate Hydrochloride (N-Butylnorhyoscine Hydrochloride), N-Butyl nor scopolamine hydrochloride, Hyoscine Butylbromide Impurity 5（Hyoscine Butylbromide EP Impurity E）. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Hubei YoungXin. Available pack sizes: on request, 250mg, 25mg, 50mg, 100mg, 10mg, 200mg.
(9-butyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;hydrochloride (CAS 22235-98-9) is a chemical compound with the molecular formula C20H28ClNO4 and a molecular weight of 381.9 g/mol. IUPAC name: (9-butyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;hydrochloride. InChIKey: SSLCPCNDUBUVAN-FDOJSRBYSA-N.
| Molecular formula | C20H28ClNO4 |
|---|---|
| Molecular weight | 381.9 g/mol |
| IUPAC name | (9-butyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;hydrochloride |
| InChIKey | SSLCPCNDUBUVAN-FDOJSRBYSA-N |
| SMILES | CCCCN1C2CC(CC1C3C2O3)OC(=O)[C@H](CO)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)