CAS 42864-78-8 appears in our catalog under these names: Bevantolol HCl, Bevantolol Hydrochloride, >95% (HPLC), Bevantolol hydrochloride/ 99.74% (existing batch purity), Bevantolol hydrochloride, Bevantolol Hydrochloride, >98.0%(HPLC). Offered by: Chemat Brand, TRC, TargetMol, GLPBio, TCI. Available pack sizes: on request, 10mg, 500mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(3-methylphenoxy)propan-2-ol;hydrochloride (CAS 42864-78-8) is a chemical compound with the molecular formula C20H28ClNO4 and a molecular weight of 381.9 g/mol. IUPAC name: 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(3-methylphenoxy)propan-2-ol;hydrochloride. InChIKey: FJTKCFSPYUMXJB-UHFFFAOYSA-N.
| Molecular formula | C20H28ClNO4 |
|---|---|
| Molecular weight | 381.9 g/mol |
| IUPAC name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(3-methylphenoxy)propan-2-ol;hydrochloride |
| InChIKey | FJTKCFSPYUMXJB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OCC(CNCCC2=CC(=C(C=C2)OC)OC)O.Cl |
Computed by PubChem (NCBI)