Products 174621-46-6
CAS 174621-46-6 is the registry number for tert-Butyl (S)-2-methyl-5-oxo-2,5-dihydro-1H-pyrrole-1-carboxylate, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Tert-butyl (2S)-2-methyl-5-oxo-2H-pyrrole-1-carboxylate (CAS 174621-46-6) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: tert-butyl (2S)-2-methyl-5-oxo-2H-pyrrole-1-carboxylate. InChIKey: ZQUJUMROTWQJDY-ZETCQYMHSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | tert-butyl (2S)-2-methyl-5-oxo-2H-pyrrole-1-carboxylate |
| InChIKey | ZQUJUMROTWQJDY-ZETCQYMHSA-N |
| SMILES | C[C@H]1C=CC(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)