CAS 174623-07-5 appears in our catalog under these names: 4-(5-Formyl-thiophen-2-yl)-benzoic acid, ≥97%, ≥97%, 4-(5-Formyl-thiophen-2-yl)-benzoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
4-(5-formylthiophen-2-yl)benzoic acid (CAS 174623-07-5) is a chemical compound with the molecular formula C12H8O3S and a molecular weight of 232.26 g/mol. IUPAC name: 4-(5-formylthiophen-2-yl)benzoic acid. InChIKey: NRGPPHJDPPKYKN-UHFFFAOYSA-N.
| Molecular formula | C12H8O3S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 4-(5-formylthiophen-2-yl)benzoic acid |
| InChIKey | NRGPPHJDPPKYKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(S2)C=O)C(=O)O |
Computed by PubChem (NCBI)