CAS 26268-04-2 appears in our catalog under these names: 4H-Thieno[3,2-c]chromene-2-carboxylic acid, 4H-Thieno(3,2-c)chromene-2-carboxylic acid, >95% (HPLC), 4H-Thieno(3,2-c)chromene-2-carboxylic acid, 97%, 4H-Thieno[3,2-c][1]benzopyran-2-carboxylic acid, 96%. Offered by: Chemat, TRC, AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg, 10g.
4H-thieno[3,2-c]chromene-2-carboxylic acid (CAS 26268-04-2) is a chemical compound with the molecular formula C12H8O3S and a molecular weight of 232.26 g/mol. IUPAC name: 4H-thieno[3,2-c]chromene-2-carboxylic acid. InChIKey: ZMEWPWRPNHFDRC-UHFFFAOYSA-N.
| Molecular formula | C12H8O3S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 4H-thieno[3,2-c]chromene-2-carboxylic acid |
| InChIKey | ZMEWPWRPNHFDRC-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C3O1)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)