CAS 174733-08-5 is the registry number for 2-Amino-3-(4-(pyrrolidin-1-yl)phenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-amino-3-(4-pyrrolidin-1-ylphenyl)propanoic acid;hydrochloride (CAS 174733-08-5) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: 2-amino-3-(4-pyrrolidin-1-ylphenyl)propanoic acid;hydrochloride. InChIKey: REPCUZUHVFNRIZ-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | 2-amino-3-(4-pyrrolidin-1-ylphenyl)propanoic acid;hydrochloride |
| InChIKey | REPCUZUHVFNRIZ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC=C(C=C2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)