CAS 17474-44-1 is the registry number for 4,4'-Methylenebis(2-nitroaniline), 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-[(4-amino-3-nitrophenyl)methyl]-2-nitroaniline (CAS 17474-44-1) is a chemical compound with the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. IUPAC name: 4-[(4-amino-3-nitrophenyl)methyl]-2-nitroaniline. InChIKey: WJLPZRZKWVPCMN-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O4 |
|---|---|
| Molecular weight | 288.26 g/mol |
| IUPAC name | 4-[(4-amino-3-nitrophenyl)methyl]-2-nitroaniline |
| InChIKey | WJLPZRZKWVPCMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC2=CC(=C(C=C2)N)[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)