Products 2925095-08-3

CAS 2925095-08-3 is the registry number for CRBN ligand-664. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[7-(2,4-dioxo-1,3-diazinan-1-yl)indazol-2-yl]acetic acid (CAS 2925095-08-3) is a chemical compound with the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. IUPAC name: 2-[7-(2,4-dioxo-1,3-diazinan-1-yl)indazol-2-yl]acetic acid. InChIKey: SOPDHHOSMGIDEG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12N4O4
Molecular weight288.26 g/mol
IUPAC name2-[7-(2,4-dioxo-1,3-diazinan-1-yl)indazol-2-yl]acetic acid
InChIKeySOPDHHOSMGIDEG-UHFFFAOYSA-N
SMILESC1CN(C(=O)NC1=O)C2=CC=CC3=CN(N=C32)CC(=O)O

Computed by PubChem (NCBI)