CAS 2925085-48-7 appears in our catalog under these names: 3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methyl-1H-indazole-7-carboxylic acid, 95%, 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-1-methyl-1H-indazole-7-carboxylic acid, 95%, 95%, CRBN ligand-767. Offered by: Chemat Brand, Chemat, MedChemExpress. Available pack sizes: on request, 50mg, 100mg, 1g, Get quote.
3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazole-7-carboxylic acid (CAS 2925085-48-7) is a chemical compound with the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. IUPAC name: 3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazole-7-carboxylic acid. InChIKey: UOOCPUJDZXNEND-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O4 |
|---|---|
| Molecular weight | 288.26 g/mol |
| IUPAC name | 3-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindazole-7-carboxylic acid |
| InChIKey | UOOCPUJDZXNEND-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2C(=O)O)C(=N1)N3CCC(=O)NC3=O |
Computed by PubChem (NCBI)