CAS 1748-89-6 appears in our catalog under these names: 2,2'-Bipyridine-4-Carboxylic Acid, (2,2'–bipyridine)–4–carboxylic acid, [2,2'-Bipyridine]-4-carboxylic acid 95%, 2,2'-Bipyridine-4-carboxylic acid, 97%. Offered by: Chemat Brand, GLPBio, Ambeed, Fluorochem. Available pack sizes: on request, 100mg, 1g, 250mg, 50mg, 5g, 25g.
2-pyridin-2-ylpyridine-4-carboxylic acid (CAS 1748-89-6) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 2-pyridin-2-ylpyridine-4-carboxylic acid. InChIKey: FRYSEKUUHUUJPX-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-pyridin-2-ylpyridine-4-carboxylic acid |
| InChIKey | FRYSEKUUHUUJPX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)