CAS 17484-36-5 appears in our catalog under these names: 4-Methyl-3-nitroanisole, 4–Methyl–3–nitroanisole, 4-Methyl-3-nitroanisole 98%, 4-Methyl-3-nitroanisole, 98%, 98%, 4-Methyl-3-nitroanisole, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 25g, 5g, 100g, 1g, 10g, 50g.
4-methoxy-1-methyl-2-nitrobenzene (CAS 17484-36-5) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4-methoxy-1-methyl-2-nitrobenzene. InChIKey: JBORNNNGTJSTLC-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4-methoxy-1-methyl-2-nitrobenzene |
| InChIKey | JBORNNNGTJSTLC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)