Products 174873-05-3
CAS 174873-05-3 appears in our catalog under these names: Geranylgeraniol-d5 (major), Geranylgeraniol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
(2E,6E,10E)-1,1-dideuterio-7,11,15-trimethyl-3-(trideuteriomethyl)hexadeca-2,6,10,14-tetraen-1-ol (CAS 174873-05-3) is a chemical compound with the molecular formula C20H34O and a molecular weight of 295.5 g/mol. IUPAC name: (2E,6E,10E)-1,1-dideuterio-7,11,15-trimethyl-3-(trideuteriomethyl)hexadeca-2,6,10,14-tetraen-1-ol. InChIKey: OJISWRZIEWCUBN-ATCUSSGHSA-N.
| Molecular formula | C20H34O |
|---|---|
| Molecular weight | 295.5 g/mol |
| IUPAC name | (2E,6E,10E)-1,1-dideuterio-7,11,15-trimethyl-3-(trideuteriomethyl)hexadeca-2,6,10,14-tetraen-1-ol |
| InChIKey | OJISWRZIEWCUBN-ATCUSSGHSA-N |
| SMILES | [2H]C([2H])([2H])/C(=C\C([2H])([2H])O)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Geranylgeraniol-d5 (major)