CAS 187268-51-5 is the registry number for Geranylgeraniol-13C4. Offered by: TRC. Available pack sizes: 25mg.
(2E,6E,10E)-3,7,11,15-tetramethyl(1,2,3,4-13C4)hexadeca-2,6,10,14-tetraen-1-ol (CAS 187268-51-5) is a chemical compound with the molecular formula C20H34O and a molecular weight of 294.45 g/mol. IUPAC name: (2E,6E,10E)-3,7,11,15-tetramethyl(1,2,3,4-13C4)hexadeca-2,6,10,14-tetraen-1-ol. InChIKey: OJISWRZIEWCUBN-HYZWDYFKSA-N.
| Molecular formula | C20H34O |
|---|---|
| Molecular weight | 294.45 g/mol |
| IUPAC name | (2E,6E,10E)-3,7,11,15-tetramethyl(1,2,3,4-13C4)hexadeca-2,6,10,14-tetraen-1-ol |
| InChIKey | OJISWRZIEWCUBN-HYZWDYFKSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/C[13CH2]/[13C](=[13CH]/[13CH2]O)/C)/C)/C)C |
Computed by PubChem (NCBI)