CAS 3790-76-9 is the registry number for Teprenone Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
(6Z,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol (CAS 3790-76-9) is a chemical compound with the molecular formula C20H34O and a molecular weight of 290.5 g/mol. IUPAC name: (6Z,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol. InChIKey: IQDXAJNQKSIPGB-BUFWFCRBSA-N.
| Molecular formula | C20H34O |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | (6Z,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol |
| InChIKey | IQDXAJNQKSIPGB-BUFWFCRBSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C\CCC(C)(C=C)O)/C)/C)C |
Computed by PubChem (NCBI)