Products 174899-65-1
CAS 174899-65-1 appears in our catalog under these names: 1H-Imidazolium, 3-ethyl-1-methyl-, 2,2,2-trifluoroacetate (1:1), 99%, 1–ethyl–3–methylimidazolium trifluoroacetate, 1-ethyl-3-methylimidazolium trifluoroacetate, 99%, 1-Ethyl-3-methylimidazolium Trifluoroacetate, >97.0%(T), 1-ETHYL-3-METHYLIMIDAZOLIUM TRIFLUOROACETATE, 99%, 99%. Offered by: Fluorochem, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
1-ethyl-3-methylimidazol-3-ium;2,2,2-trifluoroacetate (CAS 174899-65-1) is a chemical compound with the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;2,2,2-trifluoroacetate. InChIKey: JOKVYNJKBRLDAT-UHFFFAOYSA-M.
| Molecular formula | C8H11F3N2O2 |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;2,2,2-trifluoroacetate |
| InChIKey | JOKVYNJKBRLDAT-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.C(=O)(C(F)(F)F)[O-] |
Computed by PubChem (NCBI)