CAS 2863686-96-6 is the registry number for 2-(1-Methylazetidin-3-yl)acetonitrile 2,2,2-trifluoroacetate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(1-methylazetidin-3-yl)acetonitrile;2,2,2-trifluoroacetic acid (CAS 2863686-96-6) is a chemical compound with the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. IUPAC name: 2-(1-methylazetidin-3-yl)acetonitrile;2,2,2-trifluoroacetic acid. InChIKey: AUWLZYMPVQJOKI-UHFFFAOYSA-N.
| Molecular formula | C8H11F3N2O2 |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | 2-(1-methylazetidin-3-yl)acetonitrile;2,2,2-trifluoroacetic acid |
| InChIKey | AUWLZYMPVQJOKI-UHFFFAOYSA-N |
| SMILES | CN1CC(C1)CC#N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)