CAS 2173053-01-3 is the registry number for Cis-2-aminocyclopentane-1-carbonitrile trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile;2,2,2-trifluoroacetic acid (CAS 2173053-01-3) is a chemical compound with the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. IUPAC name: trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile;2,2,2-trifluoroacetic acid. InChIKey: IMCGYFYHVJAQDM-GEMLJDPKSA-N.
| Molecular formula | C8H11F3N2O2 |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile;2,2,2-trifluoroacetic acid |
| InChIKey | IMCGYFYHVJAQDM-GEMLJDPKSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)C#N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)