CAS 1750-36-3 appears in our catalog under these names: (E)-N,1-Diphenylmethanimine, (E)-N-Benzylideneaniline 96%, (E)-N-Benzylideneaniline, 98%, 98%, (E)-N-Benzylideneaniline, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 100g, 1g.
N,1-diphenylmethanimine (CAS 1750-36-3) is a chemical compound with the molecular formula C13H11N and a molecular weight of 181.23 g/mol. IUPAC name: N,1-diphenylmethanimine. InChIKey: UVEWQKMPXAHFST-UHFFFAOYSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | N,1-diphenylmethanimine |
| InChIKey | UVEWQKMPXAHFST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)