CAS 6344-63-4 is the registry number for 9H-Fluoren-1-amine. Offered by: TRC. Available pack sizes: 1g.
9H-fluoren-1-amine (CAS 6344-63-4) is a chemical compound with the molecular formula C13H11N and a molecular weight of 181.23 g/mol. IUPAC name: 9H-fluoren-1-amine. InChIKey: CYSPWCARDHRYJX-UHFFFAOYSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | 9H-fluoren-1-amine |
| InChIKey | CYSPWCARDHRYJX-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C(=CC=C3)N |
Computed by PubChem (NCBI)