CAS 175136-24-0 appears in our catalog under these names: 4′–(4–Fluorobenzyloxy)–3′–nitroacetophenone, 1-(4-((4-Fluorobenzyl)oxy)-3-nitrophenyl)ethanone, 95%+, 95%+. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-[4-[(4-fluorophenyl)methoxy]-3-nitrophenyl]ethanone (CAS 175136-24-0) is a chemical compound with the molecular formula C15H12FNO4 and a molecular weight of 289.26 g/mol. IUPAC name: 1-[4-[(4-fluorophenyl)methoxy]-3-nitrophenyl]ethanone. InChIKey: XMYCVHFGYFJOJX-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO4 |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | 1-[4-[(4-fluorophenyl)methoxy]-3-nitrophenyl]ethanone |
| InChIKey | XMYCVHFGYFJOJX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OCC2=CC=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)