CAS 748776-38-7 appears in our catalog under these names: 2-[(2-Fluoro-phenylcarbamoyl)-methoxy]-benzoic acid, 95%, 2-{((2-Fluorophenyl)carbamoyl)methoxy}benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 0,5g.
2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoic acid (CAS 748776-38-7) is a chemical compound with the molecular formula C15H12FNO4 and a molecular weight of 289.26 g/mol. IUPAC name: 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoic acid. InChIKey: DIAPZYQWCZGAOV-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO4 |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | 2-[2-(2-fluoroanilino)-2-oxoethoxy]benzoic acid |
| InChIKey | DIAPZYQWCZGAOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OCC(=O)NC2=CC=CC=C2F |
Computed by PubChem (NCBI)