CAS 723245-50-9 appears in our catalog under these names: 3-{((4-fluorophenyl)carbamoyl)methoxy}benzoic acid, 95%, 3-{((4-Fluorophenyl)carbamoyl)methoxy}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-[2-(4-fluoroanilino)-2-oxoethoxy]benzoic acid (CAS 723245-50-9) is a chemical compound with the molecular formula C15H12FNO4 and a molecular weight of 289.26 g/mol. IUPAC name: 3-[2-(4-fluoroanilino)-2-oxoethoxy]benzoic acid. InChIKey: JVQKBINYWGCYFM-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO4 |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | 3-[2-(4-fluoroanilino)-2-oxoethoxy]benzoic acid |
| InChIKey | JVQKBINYWGCYFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)NC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)