Products 175136-71-7
CAS 175136-71-7 appears in our catalog under these names: 2-(2,6-Dimethylmorpholino)-5-nitrobenzoic acid, 95%, 2-(2,6-Dimethylmorpholino)-5-nitrobenzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoic acid (CAS 175136-71-7) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: 2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoic acid. InChIKey: UIPNFRABNZPIBW-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzoic acid |
| InChIKey | UIPNFRABNZPIBW-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)