CAS 3235-17-4 appears in our catalog under these names: Z-Ala-Gly-OH, 98%, ((Benzyloxy)carbonyl)-L-alanylglycine, 96%, Z–Ala–Gly–OH, Z-Ala-Gly-OH, 98%, 98%, Cbz-Ala-Gly-OH, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 100mg, 250mg, 50g.
2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid (CAS 3235-17-4) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: 2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid. InChIKey: RNBMQRYMCAVZPN-VIFPVBQESA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
| InChIKey | RNBMQRYMCAVZPN-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)